C23H19FIN3O3 — CID 121062019
4-[(4-fluorobenzoyl)amino]-N-[2-[(4-iodobenzoyl)amino]ethyl]benzamide (PubChem CID 121062019) has the molecular formula C23H19FIN3O3 and a molecular weight of 531.33 g/mol. Its IUPAC name is 4-[(4-fluorobenzoyl)amino]-N-[2-[(4-iodobenzoyl)amino]ethyl]benzamide.
| Compound Name | 4-[(4-fluorobenzoyl)amino]-N-[2-[(4-iodobenzoyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 121062019 |
| Molecular Formula | C23H19FIN3O3 |
| Molecular Weight | 531.33 g/mol |
| Exact Mass | 531.05 |
| IUPAC Name | 4-[(4-fluorobenzoyl)amino]-N-[2-[(4-iodobenzoyl)amino]ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)c1ccc(NC(=O)c2ccc(F)cc2)cc1)c1ccc(I)cc1 |
| InChI | InChI=1S/C23H19FIN3O3/c24-18-7-1-17(2-8-18)23(31)28-20-11-5-16(6-12-20)22(30)27-14-13-26-21(29)15-3-9-19(25)10-4-15/h1-12H,13-14H2,(H,26,29)(H,27,30)(H,28,31) |
| InChIKey | IKJINDISBQVOHP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|