C23H17BrN2O6S — CID 3290288
N-[5-[(4-bromophenyl)sulfamoyl]-2-methoxyphenyl]-2-oxochromene-3-carboxamide (PubChem CID 3290288) has the molecular formula C23H17BrN2O6S and a molecular weight of 529.37 g/mol. Its IUPAC name is N-[5-[(4-bromophenyl)sulfamoyl]-2-methoxyphenyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[5-[(4-bromophenyl)sulfamoyl]-2-methoxyphenyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 3290288 |
| Molecular Formula | C23H17BrN2O6S |
| Molecular Weight | 529.37 g/mol |
| Exact Mass | 528.00 |
| IUPAC Name | N-[5-[(4-bromophenyl)sulfamoyl]-2-methoxyphenyl]-2-oxochromene-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(Br)cc2)cc1NC(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C23H17BrN2O6S/c1-31-21-11-10-17(33(29,30)26-16-8-6-15(24)7-9-16)13-19(21)25-22(27)18-12-14-4-2-3-5-20(14)32-23(18)28/h2-13,26H,1H3,(H,25,27) |
| InChIKey | FUMPKWRDNWZLKO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|