C24H18N2O6S — CID 5011081
methyl 4-methyl-2-[(2-oxochromene-3-carbonyl)amino]-5-(phenylcarbamoyl)thiophene-3-carboxylate (PubChem CID 5011081) has the molecular formula C24H18N2O6S and a molecular weight of 462.48 g/mol. Its IUPAC name is methyl 4-methyl-2-[(2-oxochromene-3-carbonyl)amino]-5-(phenylcarbamoyl)thiophene-3-carboxylate.
| Compound Name | methyl 4-methyl-2-[(2-oxochromene-3-carbonyl)amino]-5-(phenylcarbamoyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 5011081 |
| Molecular Formula | C24H18N2O6S |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | methyl 4-methyl-2-[(2-oxochromene-3-carbonyl)amino]-5-(phenylcarbamoyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2cc3ccccc3oc2=O)sc(C(=O)Nc2ccccc2)c1C |
| InChI | InChI=1S/C24H18N2O6S/c1-13-18(24(30)31-2)22(33-19(13)21(28)25-15-9-4-3-5-10-15)26-20(27)16-12-14-8-6-7-11-17(14)32-23(16)29/h3-12H,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | OGDDKQXRKFOFDX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|