C22H21NO7S — CID 1188253
4-O-ethyl 2-O-propan-2-yl 3-methyl-5-[(2-oxochromene-3-carbonyl)amino]thiophene-2,4-dicarboxylate (PubChem CID 1188253) has the molecular formula C22H21NO7S and a molecular weight of 443.48 g/mol. Its IUPAC name is 4-O-ethyl 2-O-propan-2-yl 3-methyl-5-[(2-oxochromene-3-carbonyl)amino]thiophene-2,4-dicarboxylate.
| Compound Name | 4-O-ethyl 2-O-propan-2-yl 3-methyl-5-[(2-oxochromene-3-carbonyl)amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 1188253 |
| Molecular Formula | C22H21NO7S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 4-O-ethyl 2-O-propan-2-yl 3-methyl-5-[(2-oxochromene-3-carbonyl)amino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2cc3ccccc3oc2=O)sc(C(=O)OC(C)C)c1C |
| InChI | InChI=1S/C22H21NO7S/c1-5-28-21(26)16-12(4)17(22(27)29-11(2)3)31-19(16)23-18(24)14-10-13-8-6-7-9-15(13)30-20(14)25/h6-11H,5H2,1-4H3,(H,23,24) |
| InChIKey | FMNHRNZUPUMGTQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|