C26H21NO5S — CID 19227436
methyl 2-[(2-oxochromene-3-carbonyl)amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate (PubChem CID 19227436) has the molecular formula C26H21NO5S and a molecular weight of 459.52 g/mol. Its IUPAC name is methyl 2-[(2-oxochromene-3-carbonyl)amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[(2-oxochromene-3-carbonyl)amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19227436 |
| Molecular Formula | C26H21NO5S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | methyl 2-[(2-oxochromene-3-carbonyl)amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc3c(c2)CCCC3)csc1NC(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C26H21NO5S/c1-31-26(30)22-20(17-11-10-15-6-2-3-7-16(15)12-17)14-33-24(22)27-23(28)19-13-18-8-4-5-9-21(18)32-25(19)29/h4-5,8-14H,2-3,6-7H2,1H3,(H,27,28) |
| InChIKey | ORADVWLMQNTVTD-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|