C31H24N2O5S — CID 19228443
methyl 2-[[4-(1,3-dioxoisoindol-2-yl)benzoyl]amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate (PubChem CID 19228443) has the molecular formula C31H24N2O5S and a molecular weight of 536.61 g/mol. Its IUPAC name is methyl 2-[[4-(1,3-dioxoisoindol-2-yl)benzoyl]amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[4-(1,3-dioxoisoindol-2-yl)benzoyl]amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19228443 |
| Molecular Formula | C31H24N2O5S |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | methyl 2-[[4-(1,3-dioxoisoindol-2-yl)benzoyl]amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc3c(c2)CCCC3)csc1NC(=O)c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C31H24N2O5S/c1-38-31(37)26-25(21-11-10-18-6-2-3-7-20(18)16-21)17-39-28(26)32-27(34)19-12-14-22(15-13-19)33-29(35)23-8-4-5-9-24(23)30(33)36/h4-5,8-17H,2-3,6-7H2,1H3,(H,32,34) |
| InChIKey | OYRPUIYXAHIERR-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|