C21H17ClN2O6S — CID 19217402
methyl 4-(3-chlorophenyl)-5-methyl-2-[[2-(4-nitrophenoxy)acetyl]amino]thiophene-3-carboxylate (PubChem CID 19217402) has the molecular formula C21H17ClN2O6S and a molecular weight of 460.90 g/mol. Its IUPAC name is methyl 4-(3-chlorophenyl)-5-methyl-2-[[2-(4-nitrophenoxy)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(3-chlorophenyl)-5-methyl-2-[[2-(4-nitrophenoxy)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19217402 |
| Molecular Formula | C21H17ClN2O6S |
| Molecular Weight | 460.90 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | methyl 4-(3-chlorophenyl)-5-methyl-2-[[2-(4-nitrophenoxy)acetyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)COc2ccc([N+](=O)[O-])cc2)sc(C)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H17ClN2O6S/c1-12-18(13-4-3-5-14(22)10-13)19(21(26)29-2)20(31-12)23-17(25)11-30-16-8-6-15(7-9-16)24(27)28/h3-10H,11H2,1-2H3,(H,23,25) |
| InChIKey | MXLUXPIEGPHUFC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.90 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|