C22H23N3O3S — CID 1017753
ethyl 5-methyl-4-(4-propylphenyl)-2-(pyrazine-2-carbonylamino)thiophene-3-carboxylate (PubChem CID 1017753) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is ethyl 5-methyl-4-(4-propylphenyl)-2-(pyrazine-2-carbonylamino)thiophene-3-carboxylate.
| Compound Name | ethyl 5-methyl-4-(4-propylphenyl)-2-(pyrazine-2-carbonylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 1017753 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | ethyl 5-methyl-4-(4-propylphenyl)-2-(pyrazine-2-carbonylamino)thiophene-3-carboxylate |
| SMILES | CCCc1ccc(-c2c(C)sc(NC(=O)c3cnccn3)c2C(=O)OCC)cc1 |
| InChI | InChI=1S/C22H23N3O3S/c1-4-6-15-7-9-16(10-8-15)18-14(3)29-21(19(18)22(27)28-5-2)25-20(26)17-13-23-11-12-24-17/h7-13H,4-6H2,1-3H3,(H,25,26) |
| InChIKey | XQFPOOXGFPFZCN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|