C20H18ClN3O3S — CID 4188307
propan-2-yl 4-(4-chlorophenyl)-5-methyl-2-(pyrazine-2-carbonylamino)thiophene-3-carboxylate (PubChem CID 4188307) has the molecular formula C20H18ClN3O3S and a molecular weight of 415.90 g/mol. Its IUPAC name is propan-2-yl 4-(4-chlorophenyl)-5-methyl-2-(pyrazine-2-carbonylamino)thiophene-3-carboxylate.
| Compound Name | propan-2-yl 4-(4-chlorophenyl)-5-methyl-2-(pyrazine-2-carbonylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4188307 |
| Molecular Formula | C20H18ClN3O3S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | propan-2-yl 4-(4-chlorophenyl)-5-methyl-2-(pyrazine-2-carbonylamino)thiophene-3-carboxylate |
| SMILES | Cc1sc(NC(=O)c2cnccn2)c(C(=O)OC(C)C)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClN3O3S/c1-11(2)27-20(26)17-16(13-4-6-14(21)7-5-13)12(3)28-19(17)24-18(25)15-10-22-8-9-23-15/h4-11H,1-3H3,(H,24,25) |
| InChIKey | CLPNPURXHILJJL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|