C18H15FN2O3S2 — CID 84560402
ethyl 4-(4-fluorophenyl)-5-methyl-2-(1,3-thiazole-4-carbonylamino)thiophene-3-carboxylate (PubChem CID 84560402) has the molecular formula C18H15FN2O3S2 and a molecular weight of 390.46 g/mol. Its IUPAC name is ethyl 4-(4-fluorophenyl)-5-methyl-2-(1,3-thiazole-4-carbonylamino)thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-fluorophenyl)-5-methyl-2-(1,3-thiazole-4-carbonylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 84560402 |
| Molecular Formula | C18H15FN2O3S2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | ethyl 4-(4-fluorophenyl)-5-methyl-2-(1,3-thiazole-4-carbonylamino)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2cscn2)sc(C)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15FN2O3S2/c1-3-24-18(23)15-14(11-4-6-12(19)7-5-11)10(2)26-17(15)21-16(22)13-8-25-9-20-13/h4-9H,3H2,1-2H3,(H,21,22) |
| InChIKey | MHIWWGULGMAHEW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|