C19H16FN3O3S — CID 4570373
ethyl 4-(4-fluorophenyl)-5-methyl-2-(pyrazine-2-carbonylamino)thiophene-3-carboxylate (PubChem CID 4570373) has the molecular formula C19H16FN3O3S and a molecular weight of 385.42 g/mol. Its IUPAC name is ethyl 4-(4-fluorophenyl)-5-methyl-2-(pyrazine-2-carbonylamino)thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-fluorophenyl)-5-methyl-2-(pyrazine-2-carbonylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4570373 |
| Molecular Formula | C19H16FN3O3S |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | ethyl 4-(4-fluorophenyl)-5-methyl-2-(pyrazine-2-carbonylamino)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2cnccn2)sc(C)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H16FN3O3S/c1-3-26-19(25)16-15(12-4-6-13(20)7-5-12)11(2)27-18(16)23-17(24)14-10-21-8-9-22-14/h4-10H,3H2,1-2H3,(H,23,24) |
| InChIKey | OKRSYUSMRFULTH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|