C15H12N2O3S3 — CID 84560643
ethyl 2-(1,3-thiazole-4-carbonylamino)-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 84560643) has the molecular formula C15H12N2O3S3 and a molecular weight of 364.47 g/mol. Its IUPAC name is ethyl 2-(1,3-thiazole-4-carbonylamino)-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | ethyl 2-(1,3-thiazole-4-carbonylamino)-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 84560643 |
| Molecular Formula | C15H12N2O3S3 |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | ethyl 2-(1,3-thiazole-4-carbonylamino)-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cccs2)csc1NC(=O)c1cscn1 |
| InChI | InChI=1S/C15H12N2O3S3/c1-2-20-15(19)12-9(11-4-3-5-22-11)6-23-14(12)17-13(18)10-7-21-8-16-10/h3-8H,2H2,1H3,(H,17,18) |
| InChIKey | HUBBVCUTHRHLEW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|