C20H16ClN3O3S2 — CID 84567650
ethyl 2-[(7-chloro-2-methylimidazo[1,2-a]pyridine-3-carbonyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 84567650) has the molecular formula C20H16ClN3O3S2 and a molecular weight of 445.95 g/mol. Its IUPAC name is ethyl 2-[(7-chloro-2-methylimidazo[1,2-a]pyridine-3-carbonyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(7-chloro-2-methylimidazo[1,2-a]pyridine-3-carbonyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 84567650 |
| Molecular Formula | C20H16ClN3O3S2 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | ethyl 2-[(7-chloro-2-methylimidazo[1,2-a]pyridine-3-carbonyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cccs2)csc1NC(=O)c1c(C)nc2cc(Cl)ccn12 |
| InChI | InChI=1S/C20H16ClN3O3S2/c1-3-27-20(26)16-13(14-5-4-8-28-14)10-29-19(16)23-18(25)17-11(2)22-15-9-12(21)6-7-24(15)17/h4-10H,3H2,1-2H3,(H,23,25) |
| InChIKey | RRLQKYCTYOXSHW-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|