C16H16N4O3S3 — CID 2513706
ethyl 2-[[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 2513706) has the molecular formula C16H16N4O3S3 and a molecular weight of 408.53 g/mol. Its IUPAC name is ethyl 2-[[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2513706 |
| Molecular Formula | C16H16N4O3S3 |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | ethyl 2-[[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cccs2)csc1NC(=O)CSc1nncn1C |
| InChI | InChI=1S/C16H16N4O3S3/c1-3-23-15(22)13-10(11-5-4-6-24-11)7-25-14(13)18-12(21)8-26-16-19-17-9-20(16)2/h4-7,9H,3,8H2,1-2H3,(H,18,21) |
| InChIKey | ONUPPVZJIJINTB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|