C21H17N3O3S3 — CID 3415841
ethyl 2-[(2-quinazolin-4-ylsulfanylacetyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 3415841) has the molecular formula C21H17N3O3S3 and a molecular weight of 455.59 g/mol. Its IUPAC name is ethyl 2-[(2-quinazolin-4-ylsulfanylacetyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2-quinazolin-4-ylsulfanylacetyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3415841 |
| Molecular Formula | C21H17N3O3S3 |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | ethyl 2-[(2-quinazolin-4-ylsulfanylacetyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cccs2)csc1NC(=O)CSc1ncnc2ccccc12 |
| InChI | InChI=1S/C21H17N3O3S3/c1-2-27-21(26)18-14(16-8-5-9-28-16)10-29-20(18)24-17(25)11-30-19-13-6-3-4-7-15(13)22-12-23-19/h3-10,12H,2,11H2,1H3,(H,24,25) |
| InChIKey | COXZFPFYYHXLOV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|