C26H19N3O4S4 — CID 23907824
methyl 2-[[3-oxo-4-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylbutanoyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 23907824) has the molecular formula C26H19N3O4S4 and a molecular weight of 565.72 g/mol. Its IUPAC name is methyl 2-[[3-oxo-4-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylbutanoyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[3-oxo-4-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylbutanoyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 23907824 |
| Molecular Formula | C26H19N3O4S4 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.03 |
| IUPAC Name | methyl 2-[[3-oxo-4-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylbutanoyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2cccs2)csc1NC(=O)CC(=O)CSc1ncnc2sc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C26H19N3O4S4/c1-33-26(32)22-18(19-8-5-9-34-19)13-36-25(22)29-21(31)10-16(30)12-35-23-17-11-20(15-6-3-2-4-7-15)37-24(17)28-14-27-23/h2-9,11,13-14H,10,12H2,1H3,(H,29,31) |
| InChIKey | HFNWFAGZRHYHGB-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|