C28H23N3O4S2 — CID 44636762
ethyl 4-(4-methylphenyl)-2-[[2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetyl]amino]thiophene-3-carboxylate (PubChem CID 44636762) has the molecular formula C28H23N3O4S2 and a molecular weight of 529.64 g/mol. Its IUPAC name is ethyl 4-(4-methylphenyl)-2-[[2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-methylphenyl)-2-[[2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 44636762 |
| Molecular Formula | C28H23N3O4S2 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | ethyl 4-(4-methylphenyl)-2-[[2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)Cn1cnc2sc(-c3ccccc3)cc2c1=O |
| InChI | InChI=1S/C28H23N3O4S2/c1-3-35-28(34)24-21(18-11-9-17(2)10-12-18)15-36-26(24)30-23(32)14-31-16-29-25-20(27(31)33)13-22(37-25)19-7-5-4-6-8-19/h4-13,15-16H,3,14H2,1-2H3,(H,30,32) |
| InChIKey | REEPOLSDMBETFA-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|