C23H21N3O4S2 — CID 40823862
ethyl 2-[[2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 40823862) has the molecular formula C23H21N3O4S2 and a molecular weight of 467.57 g/mol. Its IUPAC name is ethyl 2-[[2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 40823862 |
| Molecular Formula | C23H21N3O4S2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | ethyl 2-[[2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)Cn1cnc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C23H21N3O4S2/c1-4-30-23(29)19-16(15-8-6-5-7-9-15)11-31-21(19)25-17(27)10-26-12-24-20-18(22(26)28)13(2)14(3)32-20/h5-9,11-12H,4,10H2,1-3H3,(H,25,27) |
| InChIKey | VAMHZAPCTBWUTI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|