C14H14ClNO3S2 — CID 2384089
methyl 2-(4-chlorobutanoylamino)-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 2384089) has the molecular formula C14H14ClNO3S2 and a molecular weight of 343.86 g/mol. Its IUPAC name is methyl 2-(4-chlorobutanoylamino)-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | methyl 2-(4-chlorobutanoylamino)-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2384089 |
| Molecular Formula | C14H14ClNO3S2 |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | methyl 2-(4-chlorobutanoylamino)-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2cccs2)csc1NC(=O)CCCCl |
| InChI | InChI=1S/C14H14ClNO3S2/c1-19-14(18)12-9(10-4-3-7-20-10)8-21-13(12)16-11(17)5-2-6-15/h3-4,7-8H,2,5-6H2,1H3,(H,16,17) |
| InChIKey | ZGYSMOZRJMMEQJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|