C20H16ClNO4S2 — CID 108807715
methyl 4-(4-chlorophenyl)-2-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]thiophene-3-carboxylate (PubChem CID 108807715) has the molecular formula C20H16ClNO4S2 and a molecular weight of 433.94 g/mol. Its IUPAC name is methyl 4-(4-chlorophenyl)-2-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-chlorophenyl)-2-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 108807715 |
| Molecular Formula | C20H16ClNO4S2 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | methyl 4-(4-chlorophenyl)-2-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(Cl)cc2)csc1NC(=O)CCC(=O)c1cccs1 |
| InChI | InChI=1S/C20H16ClNO4S2/c1-26-20(25)18-14(12-4-6-13(21)7-5-12)11-28-19(18)22-17(24)9-8-15(23)16-3-2-10-27-16/h2-7,10-11H,8-9H2,1H3,(H,22,24) |
| InChIKey | QVDDKRLSAUCDHR-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|