C26H24ClNO4S — CID 108807128
methyl 4-(4-chlorophenyl)-2-[[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoyl]amino]thiophene-3-carboxylate (PubChem CID 108807128) has the molecular formula C26H24ClNO4S and a molecular weight of 482.00 g/mol. Its IUPAC name is methyl 4-(4-chlorophenyl)-2-[[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-chlorophenyl)-2-[[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 108807128 |
| Molecular Formula | C26H24ClNO4S |
| Molecular Weight | 482.00 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | methyl 4-(4-chlorophenyl)-2-[[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(Cl)cc2)csc1NC(=O)CCC(=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C26H24ClNO4S/c1-32-26(31)24-21(17-8-10-20(27)11-9-17)15-33-25(24)28-23(30)13-12-22(29)19-7-6-16-4-2-3-5-18(16)14-19/h6-11,14-15H,2-5,12-13H2,1H3,(H,28,30) |
| InChIKey | MZYWUIYKDANHDG-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.00 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|