C18H15NO3S2 — CID 1012402
methyl 4-(4-methylphenyl)-2-(thiophene-2-carbonylamino)thiophene-3-carboxylate (PubChem CID 1012402) has the molecular formula C18H15NO3S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is methyl 4-(4-methylphenyl)-2-(thiophene-2-carbonylamino)thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-methylphenyl)-2-(thiophene-2-carbonylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 1012402 |
| Molecular Formula | C18H15NO3S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | methyl 4-(4-methylphenyl)-2-(thiophene-2-carbonylamino)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)c1cccs1 |
| InChI | InChI=1S/C18H15NO3S2/c1-11-5-7-12(8-6-11)13-10-24-17(15(13)18(21)22-2)19-16(20)14-4-3-9-23-14/h3-10H,1-2H3,(H,19,20) |
| InChIKey | YVOQEHAHVGDLNG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|