C23H18N2O4S2 — CID 42981562
[2-(1-methylpyrrol-2-yl)-2-oxoethyl] 4-phenyl-2-(thiophene-2-carbonylamino)thiophene-3-carboxylate (PubChem CID 42981562) has the molecular formula C23H18N2O4S2 and a molecular weight of 450.54 g/mol. Its IUPAC name is [2-(1-methylpyrrol-2-yl)-2-oxoethyl] 4-phenyl-2-(thiophene-2-carbonylamino)thiophene-3-carboxylate.
| Compound Name | [2-(1-methylpyrrol-2-yl)-2-oxoethyl] 4-phenyl-2-(thiophene-2-carbonylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 42981562 |
| Molecular Formula | C23H18N2O4S2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | [2-(1-methylpyrrol-2-yl)-2-oxoethyl] 4-phenyl-2-(thiophene-2-carbonylamino)thiophene-3-carboxylate |
| SMILES | Cn1cccc1C(=O)COC(=O)c1c(-c2ccccc2)csc1NC(=O)c1cccs1 |
| InChI | InChI=1S/C23H18N2O4S2/c1-25-11-5-9-17(25)18(26)13-29-23(28)20-16(15-7-3-2-4-8-15)14-31-22(20)24-21(27)19-10-6-12-30-19/h2-12,14H,13H2,1H3,(H,24,27) |
| InChIKey | UPSVPYCWSWJGAO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|