C26H25N3O5S — CID 16514473
[2-(4-acetamidoanilino)-2-oxoethyl] 2-(3-methylbut-2-enoylamino)-4-phenylthiophene-3-carboxylate (PubChem CID 16514473) has the molecular formula C26H25N3O5S and a molecular weight of 491.57 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl] 2-(3-methylbut-2-enoylamino)-4-phenylthiophene-3-carboxylate.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl] 2-(3-methylbut-2-enoylamino)-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 16514473 |
| Molecular Formula | C26H25N3O5S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl] 2-(3-methylbut-2-enoylamino)-4-phenylthiophene-3-carboxylate |
| SMILES | CC(=O)Nc1ccc(NC(=O)COC(=O)c2c(-c3ccccc3)csc2NC(=O)C=C(C)C)cc1 |
| InChI | InChI=1S/C26H25N3O5S/c1-16(2)13-22(31)29-25-24(21(15-35-25)18-7-5-4-6-8-18)26(33)34-14-23(32)28-20-11-9-19(10-12-20)27-17(3)30/h4-13,15H,14H2,1-3H3,(H,27,30)(H,28,32)(H,29,31) |
| InChIKey | VHSAIAVZOZBWGJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|