C26H26N2O6S — CID 16514462
[2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-(3-methylbut-2-enoylamino)-4-phenylthiophene-3-carboxylate (PubChem CID 16514462) has the molecular formula C26H26N2O6S and a molecular weight of 494.57 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-(3-methylbut-2-enoylamino)-4-phenylthiophene-3-carboxylate.
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-(3-methylbut-2-enoylamino)-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 16514462 |
| Molecular Formula | C26H26N2O6S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-(3-methylbut-2-enoylamino)-4-phenylthiophene-3-carboxylate |
| SMILES | COc1ccc(OC)c(NC(=O)COC(=O)c2c(-c3ccccc3)csc2NC(=O)C=C(C)C)c1 |
| InChI | InChI=1S/C26H26N2O6S/c1-16(2)12-22(29)28-25-24(19(15-35-25)17-8-6-5-7-9-17)26(31)34-14-23(30)27-20-13-18(32-3)10-11-21(20)33-4/h5-13,15H,14H2,1-4H3,(H,27,30)(H,28,29) |
| InChIKey | PBFGGWCATRUCCH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|