C26H25NO5S — CID 2468724
(5-acetyl-2-methoxyphenyl)methyl 2-(3-methylbut-2-enoylamino)-4-phenylthiophene-3-carboxylate (PubChem CID 2468724) has the molecular formula C26H25NO5S and a molecular weight of 463.56 g/mol. Its IUPAC name is (5-acetyl-2-methoxyphenyl)methyl 2-(3-methylbut-2-enoylamino)-4-phenylthiophene-3-carboxylate.
| Compound Name | (5-acetyl-2-methoxyphenyl)methyl 2-(3-methylbut-2-enoylamino)-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2468724 |
| Molecular Formula | C26H25NO5S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | (5-acetyl-2-methoxyphenyl)methyl 2-(3-methylbut-2-enoylamino)-4-phenylthiophene-3-carboxylate |
| SMILES | COc1ccc(C(C)=O)cc1COC(=O)c1c(-c2ccccc2)csc1NC(=O)C=C(C)C |
| InChI | InChI=1S/C26H25NO5S/c1-16(2)12-23(29)27-25-24(21(15-33-25)18-8-6-5-7-9-18)26(30)32-14-20-13-19(17(3)28)10-11-22(20)31-4/h5-13,15H,14H2,1-4H3,(H,27,29) |
| InChIKey | WQBTYXNKNXKLBE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|