C25H22N2O7S — CID 4842349
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-(3-methylbut-2-enoylamino)-4-phenylthiophene-3-carboxylate (PubChem CID 4842349) has the molecular formula C25H22N2O7S and a molecular weight of 494.53 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-(3-methylbut-2-enoylamino)-4-phenylthiophene-3-carboxylate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-(3-methylbut-2-enoylamino)-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 4842349 |
| Molecular Formula | C25H22N2O7S |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-(3-methylbut-2-enoylamino)-4-phenylthiophene-3-carboxylate |
| SMILES | CC(C)=CC(=O)Nc1scc(-c2ccccc2)c1C(=O)OCc1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C25H22N2O7S/c1-15(2)8-21(28)26-24-22(20(13-35-24)16-6-4-3-5-7-16)25(29)33-12-18-10-19(27(30)31)9-17-11-32-14-34-23(17)18/h3-10,13H,11-12,14H2,1-2H3,(H,26,28) |
| InChIKey | WOWNSVQWBWAHAJ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|