C21H19NO4S2 — CID 16644359
methyl 2-[[2-(2-prop-2-enylphenoxy)acetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 16644359) has the molecular formula C21H19NO4S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is methyl 2-[[2-(2-prop-2-enylphenoxy)acetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-(2-prop-2-enylphenoxy)acetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 16644359 |
| Molecular Formula | C21H19NO4S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | methyl 2-[[2-(2-prop-2-enylphenoxy)acetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | C=CCc1ccccc1OCC(=O)Nc1scc(-c2cccs2)c1C(=O)OC |
| InChI | InChI=1S/C21H19NO4S2/c1-3-7-14-8-4-5-9-16(14)26-12-18(23)22-20-19(21(24)25-2)15(13-28-20)17-10-6-11-27-17/h3-6,8-11,13H,1,7,12H2,2H3,(H,22,23) |
| InChIKey | IBRIJBOSSLYBOM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|