C13H13N3O2S — CID 1407102
2-(2-prop-2-enylphenoxy)-N-(1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 1407102) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 2-(2-prop-2-enylphenoxy)-N-(1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(2-prop-2-enylphenoxy)-N-(1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 1407102 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 2-(2-prop-2-enylphenoxy)-N-(1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | C=CCc1ccccc1OCC(=O)Nc1nncs1 |
| InChI | InChI=1S/C13H13N3O2S/c1-2-5-10-6-3-4-7-11(10)18-8-12(17)15-13-16-14-9-19-13/h2-4,6-7,9H,1,5,8H2,(H,15,16,17) |
| InChIKey | NQWYCIQLWBSEQY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|