C10H7BrFN3O2S — CID 29369309
2-(2-bromo-4-fluorophenoxy)-N-(1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 29369309) has the molecular formula C10H7BrFN3O2S and a molecular weight of 332.15 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenoxy)-N-(1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(2-bromo-4-fluorophenoxy)-N-(1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 29369309 |
| Molecular Formula | C10H7BrFN3O2S |
| Molecular Weight | 332.15 g/mol |
| Exact Mass | 330.94 |
| IUPAC Name | 2-(2-bromo-4-fluorophenoxy)-N-(1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | O=C(COc1ccc(F)cc1Br)Nc1nncs1 |
| InChI | InChI=1S/C10H7BrFN3O2S/c11-7-3-6(12)1-2-8(7)17-4-9(16)14-10-15-13-5-18-10/h1-3,5H,4H2,(H,14,15,16) |
| InChIKey | ZDSZMMIRGYXSTA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.15 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |