C20H16Cl2N2O2S — CID 1407098
N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-(2-prop-2-enylphenoxy)acetamide (PubChem CID 1407098) has the molecular formula C20H16Cl2N2O2S and a molecular weight of 419.33 g/mol. Its IUPAC name is N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-(2-prop-2-enylphenoxy)acetamide.
| Compound Name | N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-(2-prop-2-enylphenoxy)acetamide |
|---|---|
| PubChem CID | 1407098 |
| Molecular Formula | C20H16Cl2N2O2S |
| Molecular Weight | 419.33 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-(2-prop-2-enylphenoxy)acetamide |
| SMILES | C=CCc1ccccc1OCC(=O)Nc1nc(-c2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C20H16Cl2N2O2S/c1-2-5-13-6-3-4-7-18(13)26-11-19(25)24-20-23-17(12-27-20)15-9-8-14(21)10-16(15)22/h2-4,6-10,12H,1,5,11H2,(H,23,24,25) |
| InChIKey | HKAOLAJEGBKAAQ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.33 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|