C23H16Cl2N2O2S — CID 19178578
2-(2,5-dichlorophenoxy)-N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 19178578) has the molecular formula C23H16Cl2N2O2S and a molecular weight of 455.37 g/mol. Its IUPAC name is 2-(2,5-dichlorophenoxy)-N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(2,5-dichlorophenoxy)-N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 19178578 |
| Molecular Formula | C23H16Cl2N2O2S |
| Molecular Weight | 455.37 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | 2-(2,5-dichlorophenoxy)-N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(COc1cc(Cl)ccc1Cl)Nc1nc(-c2ccc(-c3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C23H16Cl2N2O2S/c24-18-10-11-19(25)21(12-18)29-13-22(28)27-23-26-20(14-30-23)17-8-6-16(7-9-17)15-4-2-1-3-5-15/h1-12,14H,13H2,(H,26,27,28) |
| InChIKey | PBOUFHVUWAQQJO-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.37 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |