C17H10BrCl3N2O2S — CID 23904810
N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 23904810) has the molecular formula C17H10BrCl3N2O2S and a molecular weight of 492.61 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 23904810 |
| Molecular Formula | C17H10BrCl3N2O2S |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 489.87 |
| IUPAC Name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)Nc1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C17H10BrCl3N2O2S/c18-10-3-1-9(2-4-10)14-8-26-17(22-14)23-16(24)7-25-15-6-12(20)11(19)5-13(15)21/h1-6,8H,7H2,(H,22,23,24) |
| InChIKey | GILZUVMWLBLHJN-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|