C19H17BrN2O2S — CID 19175684
N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-(2-ethylphenoxy)acetamide (PubChem CID 19175684) has the molecular formula C19H17BrN2O2S and a molecular weight of 417.33 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-(2-ethylphenoxy)acetamide.
| Compound Name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-(2-ethylphenoxy)acetamide |
|---|---|
| PubChem CID | 19175684 |
| Molecular Formula | C19H17BrN2O2S |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-(2-ethylphenoxy)acetamide |
| SMILES | CCc1ccccc1OCC(=O)Nc1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C19H17BrN2O2S/c1-2-13-5-3-4-6-17(13)24-11-18(23)22-19-21-16(12-25-19)14-7-9-15(20)10-8-14/h3-10,12H,2,11H2,1H3,(H,21,22,23) |
| InChIKey | QHTCYTITDLVNDB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |