C20H17NO5S2 — CID 3433986
methyl 2-[(2-acetyloxy-2-phenylacetyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 3433986) has the molecular formula C20H17NO5S2 and a molecular weight of 415.49 g/mol. Its IUPAC name is methyl 2-[(2-acetyloxy-2-phenylacetyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(2-acetyloxy-2-phenylacetyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3433986 |
| Molecular Formula | C20H17NO5S2 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | methyl 2-[(2-acetyloxy-2-phenylacetyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2cccs2)csc1NC(=O)C(OC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C20H17NO5S2/c1-12(22)26-17(13-7-4-3-5-8-13)18(23)21-19-16(20(24)25-2)14(11-28-19)15-9-6-10-27-15/h3-11,17H,1-2H3,(H,21,23) |
| InChIKey | FTVHJJHQTWWXCB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|