C22H19NO5S — CID 1187070
methyl 2-[[(2S)-2-acetyloxy-2-phenylacetyl]amino]-5-phenylthiophene-3-carboxylate (PubChem CID 1187070) has the molecular formula C22H19NO5S and a molecular weight of 409.46 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-acetyloxy-2-phenylacetyl]amino]-5-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[(2S)-2-acetyloxy-2-phenylacetyl]amino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 1187070 |
| Molecular Formula | C22H19NO5S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | methyl 2-[[(2S)-2-acetyloxy-2-phenylacetyl]amino]-5-phenylthiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)sc1NC(=O)[C@@H](OC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C22H19NO5S/c1-14(24)28-19(16-11-7-4-8-12-16)20(25)23-21-17(22(26)27-2)13-18(29-21)15-9-5-3-6-10-15/h3-13,19H,1-2H3,(H,23,25)/t19-/m0/s1 |
| InChIKey | RPWXKGOWTPDJEM-IBGZPJMESA-N |
| XLogP | 4.44 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |