C20H21NO7S — CID 2907753
4-O-ethyl 2-O-methyl 5-[(2-acetyloxy-2-phenylacetyl)amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 2907753) has the molecular formula C20H21NO7S and a molecular weight of 419.46 g/mol. Its IUPAC name is 4-O-ethyl 2-O-methyl 5-[(2-acetyloxy-2-phenylacetyl)amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | 4-O-ethyl 2-O-methyl 5-[(2-acetyloxy-2-phenylacetyl)amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 2907753 |
| Molecular Formula | C20H21NO7S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 4-O-ethyl 2-O-methyl 5-[(2-acetyloxy-2-phenylacetyl)amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(OC(C)=O)c2ccccc2)sc(C(=O)OC)c1C |
| InChI | InChI=1S/C20H21NO7S/c1-5-27-19(24)14-11(2)16(20(25)26-4)29-18(14)21-17(23)15(28-12(3)22)13-9-7-6-8-10-13/h6-10,15H,5H2,1-4H3,(H,21,23) |
| InChIKey | ARQXUTXZAPAPTB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|