C26H26N2O5S2 — CID 5026127
diethyl 5-[(2,2-diphenylacetyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 5026127) has the molecular formula C26H26N2O5S2 and a molecular weight of 510.64 g/mol. Its IUPAC name is diethyl 5-[(2,2-diphenylacetyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[(2,2-diphenylacetyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 5026127 |
| Molecular Formula | C26H26N2O5S2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | diethyl 5-[(2,2-diphenylacetyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=S)NC(=O)C(c2ccccc2)c2ccccc2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C26H26N2O5S2/c1-4-32-24(30)19-16(3)21(25(31)33-5-2)35-23(19)28-26(34)27-22(29)20(17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-15,20H,4-5H2,1-3H3,(H2,27,28,29,34) |
| InChIKey | QOEYCLZKMWMGHL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|