C26H26N2O6S2 — CID 17314533
diethyl 3-methyl-5-[(3-phenylmethoxybenzoyl)carbamothioylamino]thiophene-2,4-dicarboxylate (PubChem CID 17314533) has the molecular formula C26H26N2O6S2 and a molecular weight of 526.64 g/mol. Its IUPAC name is diethyl 3-methyl-5-[(3-phenylmethoxybenzoyl)carbamothioylamino]thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 3-methyl-5-[(3-phenylmethoxybenzoyl)carbamothioylamino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 17314533 |
| Molecular Formula | C26H26N2O6S2 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | diethyl 3-methyl-5-[(3-phenylmethoxybenzoyl)carbamothioylamino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=S)NC(=O)c2cccc(OCc3ccccc3)c2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C26H26N2O6S2/c1-4-32-24(30)20-16(3)21(25(31)33-5-2)36-23(20)28-26(35)27-22(29)18-12-9-13-19(14-18)34-15-17-10-7-6-8-11-17/h6-14H,4-5,15H2,1-3H3,(H2,27,28,29,35) |
| InChIKey | AKGCWDRCMRWDAQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|