C20H20N2O7S2 — CID 3494062
diethyl 5-(1,3-benzodioxole-5-carbonylcarbamothioylamino)-3-methylthiophene-2,4-dicarboxylate (PubChem CID 3494062) has the molecular formula C20H20N2O7S2 and a molecular weight of 464.52 g/mol. Its IUPAC name is diethyl 5-(1,3-benzodioxole-5-carbonylcarbamothioylamino)-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-(1,3-benzodioxole-5-carbonylcarbamothioylamino)-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 3494062 |
| Molecular Formula | C20H20N2O7S2 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | diethyl 5-(1,3-benzodioxole-5-carbonylcarbamothioylamino)-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=S)NC(=O)c2ccc3c(c2)OCO3)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C20H20N2O7S2/c1-4-26-18(24)14-10(3)15(19(25)27-5-2)31-17(14)22-20(30)21-16(23)11-6-7-12-13(8-11)29-9-28-12/h6-8H,4-5,9H2,1-3H3,(H2,21,22,23,30) |
| InChIKey | YDNGOYSXXFKWTO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|