C21H24N2O5S2 — CID 2200319
diethyl 5-[(2,4-dimethylbenzoyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 2200319) has the molecular formula C21H24N2O5S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is diethyl 5-[(2,4-dimethylbenzoyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[(2,4-dimethylbenzoyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 2200319 |
| Molecular Formula | C21H24N2O5S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | diethyl 5-[(2,4-dimethylbenzoyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=S)NC(=O)c2ccc(C)cc2C)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C21H24N2O5S2/c1-6-27-19(25)15-13(5)16(20(26)28-7-2)30-18(15)23-21(29)22-17(24)14-9-8-11(3)10-12(14)4/h8-10H,6-7H2,1-5H3,(H2,22,23,24,29) |
| InChIKey | NQXLGKJXNGRYKZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|