C24H24N2O6S2 — CID 21212606
diethyl 5-[(3-methoxynaphthalene-2-carbonyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 21212606) has the molecular formula C24H24N2O6S2 and a molecular weight of 500.60 g/mol. Its IUPAC name is diethyl 5-[(3-methoxynaphthalene-2-carbonyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[(3-methoxynaphthalene-2-carbonyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 21212606 |
| Molecular Formula | C24H24N2O6S2 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | diethyl 5-[(3-methoxynaphthalene-2-carbonyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=S)NC(=O)c2cc3ccccc3cc2OC)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C24H24N2O6S2/c1-5-31-22(28)18-13(3)19(23(29)32-6-2)34-21(18)26-24(33)25-20(27)16-11-14-9-7-8-10-15(14)12-17(16)30-4/h7-12H,5-6H2,1-4H3,(H2,25,26,27,33) |
| InChIKey | BRANXPHSRPSDQA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|