C22H19ClN2O5S2 — CID 17114028
4-O-ethyl 2-O-methyl 5-[(5-chloronaphthalene-1-carbonyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 17114028) has the molecular formula C22H19ClN2O5S2 and a molecular weight of 490.99 g/mol. Its IUPAC name is 4-O-ethyl 2-O-methyl 5-[(5-chloronaphthalene-1-carbonyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | 4-O-ethyl 2-O-methyl 5-[(5-chloronaphthalene-1-carbonyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 17114028 |
| Molecular Formula | C22H19ClN2O5S2 |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | 4-O-ethyl 2-O-methyl 5-[(5-chloronaphthalene-1-carbonyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)NC(=O)c2cccc3c(Cl)cccc23)sc(C(=O)OC)c1C |
| InChI | InChI=1S/C22H19ClN2O5S2/c1-4-30-20(27)16-11(2)17(21(28)29-3)32-19(16)25-22(31)24-18(26)14-9-5-8-13-12(14)7-6-10-15(13)23/h5-10H,4H2,1-3H3,(H2,24,25,26,31) |
| InChIKey | XLNWFIXJUQGSOZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|