C19H16F4N2O6S2 — CID 17114296
4-O-ethyl 2-O-methyl 3-methyl-5-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)carbamothioylamino]thiophene-2,4-dicarboxylate (PubChem CID 17114296) has the molecular formula C19H16F4N2O6S2 and a molecular weight of 508.47 g/mol. Its IUPAC name is 4-O-ethyl 2-O-methyl 3-methyl-5-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)carbamothioylamino]thiophene-2,4-dicarboxylate.
| Compound Name | 4-O-ethyl 2-O-methyl 3-methyl-5-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)carbamothioylamino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 17114296 |
| Molecular Formula | C19H16F4N2O6S2 |
| Molecular Weight | 508.47 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | 4-O-ethyl 2-O-methyl 3-methyl-5-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)carbamothioylamino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)NC(=O)c2c(F)c(F)c(OC)c(F)c2F)sc(C(=O)OC)c1C |
| InChI | InChI=1S/C19H16F4N2O6S2/c1-5-31-17(27)7-6(2)14(18(28)30-4)33-16(7)25-19(32)24-15(26)8-9(20)11(22)13(29-3)12(23)10(8)21/h5H2,1-4H3,(H2,24,25,26,32) |
| InChIKey | GAXIMOPZQDDSHN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|