C16H13F4N3O4S2 — CID 17103897
ethyl 4-methyl-2-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)carbamothioylamino]-1,3-thiazole-5-carboxylate (PubChem CID 17103897) has the molecular formula C16H13F4N3O4S2 and a molecular weight of 451.42 g/mol. Its IUPAC name is ethyl 4-methyl-2-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)carbamothioylamino]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)carbamothioylamino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 17103897 |
| Molecular Formula | C16H13F4N3O4S2 |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | ethyl 4-methyl-2-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)carbamothioylamino]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=S)NC(=O)c2c(F)c(F)c(OC)c(F)c2F)nc1C |
| InChI | InChI=1S/C16H13F4N3O4S2/c1-4-27-14(25)12-5(2)21-16(29-12)23-15(28)22-13(24)6-7(17)9(19)11(26-3)10(20)8(6)18/h4H2,1-3H3,(H2,21,22,23,24,28) |
| InChIKey | VQZRQAOWIREXIN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|