C12H15NO5S2 — CID 87894756
4-O-ethyl 2-O-methyl 3-methyl-5-[(2-sulfanylacetyl)amino]thiophene-2,4-dicarboxylate (PubChem CID 87894756) has the molecular formula C12H15NO5S2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 4-O-ethyl 2-O-methyl 3-methyl-5-[(2-sulfanylacetyl)amino]thiophene-2,4-dicarboxylate.
| Compound Name | 4-O-ethyl 2-O-methyl 3-methyl-5-[(2-sulfanylacetyl)amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 87894756 |
| Molecular Formula | C12H15NO5S2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 4-O-ethyl 2-O-methyl 3-methyl-5-[(2-sulfanylacetyl)amino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CS)sc(C(=O)OC)c1C |
| InChI | InChI=1S/C12H15NO5S2/c1-4-18-11(15)8-6(2)9(12(16)17-3)20-10(8)13-7(14)5-19/h19H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | OWLJMWVJSQROHG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|