C19H20N4O6S2 — CID 2206882
methyl 2-[(1,3-benzodioxole-5-carbonylamino)carbamothioylamino]-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate (PubChem CID 2206882) has the molecular formula C19H20N4O6S2 and a molecular weight of 464.53 g/mol. Its IUPAC name is methyl 2-[(1,3-benzodioxole-5-carbonylamino)carbamothioylamino]-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(1,3-benzodioxole-5-carbonylamino)carbamothioylamino]-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2206882 |
| Molecular Formula | C19H20N4O6S2 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | methyl 2-[(1,3-benzodioxole-5-carbonylamino)carbamothioylamino]-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)NNC(=O)c2ccc3c(c2)OCO3)sc(C(=O)N(C)C)c1C |
| InChI | InChI=1S/C19H20N4O6S2/c1-9-13(18(26)27-4)16(31-14(9)17(25)23(2)3)20-19(30)22-21-15(24)10-5-6-11-12(7-10)29-8-28-11/h5-7H,8H2,1-4H3,(H,21,24)(H2,20,22,30) |
| InChIKey | SEANLQFNVNKOOP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|