C16H17ClN4O4S3 — CID 2955981
methyl 2-[[(5-chlorothiophene-2-carbonyl)amino]carbamothioylamino]-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate (PubChem CID 2955981) has the molecular formula C16H17ClN4O4S3 and a molecular weight of 460.99 g/mol. Its IUPAC name is methyl 2-[[(5-chlorothiophene-2-carbonyl)amino]carbamothioylamino]-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[(5-chlorothiophene-2-carbonyl)amino]carbamothioylamino]-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2955981 |
| Molecular Formula | C16H17ClN4O4S3 |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | methyl 2-[[(5-chlorothiophene-2-carbonyl)amino]carbamothioylamino]-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)NNC(=O)c2ccc(Cl)s2)sc(C(=O)N(C)C)c1C |
| InChI | InChI=1S/C16H17ClN4O4S3/c1-7-10(15(24)25-4)13(28-11(7)14(23)21(2)3)18-16(26)20-19-12(22)8-5-6-9(17)27-8/h5-6H,1-4H3,(H,19,22)(H2,18,20,26) |
| InChIKey | BBIDTPDMZGSUIQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|