C21H29N3O3S2 — CID 19651567
methyl 2-(1-adamantylcarbamothioylamino)-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate (PubChem CID 19651567) has the molecular formula C21H29N3O3S2 and a molecular weight of 435.62 g/mol. Its IUPAC name is methyl 2-(1-adamantylcarbamothioylamino)-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-(1-adamantylcarbamothioylamino)-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19651567 |
| Molecular Formula | C21H29N3O3S2 |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | methyl 2-(1-adamantylcarbamothioylamino)-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)NC23CC4CC(CC(C4)C2)C3)sc(C(=O)N(C)C)c1C |
| InChI | InChI=1S/C21H29N3O3S2/c1-11-15(19(26)27-4)17(29-16(11)18(25)24(2)3)22-20(28)23-21-8-12-5-13(9-21)7-14(6-12)10-21/h12-14H,5-10H2,1-4H3,(H2,22,23,28) |
| InChIKey | UTOQPHCONCNEAN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|