C23H33N3O3S2 — CID 19651650
methyl 2-[1-(1-adamantyl)ethylcarbamothioylamino]-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate (PubChem CID 19651650) has the molecular formula C23H33N3O3S2 and a molecular weight of 463.67 g/mol. Its IUPAC name is methyl 2-[1-(1-adamantyl)ethylcarbamothioylamino]-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[1-(1-adamantyl)ethylcarbamothioylamino]-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19651650 |
| Molecular Formula | C23H33N3O3S2 |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | methyl 2-[1-(1-adamantyl)ethylcarbamothioylamino]-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)NC(C)C23CC4CC(CC(C4)C2)C3)sc(C(=O)N(C)C)c1C |
| InChI | InChI=1S/C23H33N3O3S2/c1-12-17(21(28)29-5)19(31-18(12)20(27)26(3)4)25-22(30)24-13(2)23-9-14-6-15(10-23)8-16(7-14)11-23/h13-16H,6-11H2,1-5H3,(H2,24,25,30) |
| InChIKey | JUNMMTOYDILPRS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|